| Name | Propanedioyl dihydrazide |
| Synonyms | 358 Malonhydrazide MALONOHYDRAZIDE AKOS BBS-00001036 propanedihydrazide MALONYL DIHYDRAZIDE MALONIC DIHYDRAZIDE Malonic dihydrazide Malonic acid hydrazide MALONIC ACID DIHYDRAZIDE Propanedioyl dihydrazide Malconic acid dihydrazide |
| CAS | 3815-86-9 |
| EINECS | 670-404-5 |
| InChI | InChI=1/C3H8N4O2/c4-6-2(8)1-3(9)7-5/h1,4-5H2,(H,6,8)(H,7,9) |
| Molecular Formula | C3H8N4O2 |
| Molar Mass | 132.12 |
| Density | 1.358±0.06 g/cm3(Predicted) |
| Melting Point | 152-154°C |
| Boling Point | 554.0±33.0 °C(Predicted) |
| Flash Point | 288.8°C |
| Vapor Presure | 2.59E-12mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| BRN | 1072337 |
| pKa | 11.88±0.35(Predicted) |
| Storage Condition | Room Temprature |
| Refractive Index | 1.534 |
| MDL | MFCD00041268 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. |
| RTECS | OO8000000 |
| Hazard Class | IRRITANT |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |